Bis(N-methylcarbamic acid)2-methyl-2-propyltrimethylene ester structure
|
Common Name | Bis(N-methylcarbamic acid)2-methyl-2-propyltrimethylene ester | ||
|---|---|---|---|---|
| CAS Number | 25658-37-1 | Molecular Weight | 246.30300 | |
| Density | 1.049g/cm3 | Boiling Point | 387ºC at 760mmHg | |
| Molecular Formula | C11H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.9ºC | |
| Name | [2-methyl-2-(methylcarbamoyloxymethyl)pentyl] N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.049g/cm3 |
|---|---|
| Boiling Point | 387ºC at 760mmHg |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.30300 |
| Flash Point | 187.9ºC |
| Exact Mass | 246.15800 |
| PSA | 83.64000 |
| LogP | 1.91360 |
| Vapour Pressure | 3.4E-06mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | DWMMEAHAHZXDLA-UHFFFAOYSA-N |
| SMILES | CCCC(C)(COC(=O)NC)COC(=O)NC |
| HS Code | 2924199090 |
|---|
|
~%
Bis(N-methylcar... CAS#:25658-37-1 |
| Literature: Ludwig,B.J. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 3 p. 462 - 472 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Propanediol,2-methyl-2-propyl-,bis(methylcarbamate) |
| 2-Methyl-2-propyl-1,3-propanediol bis(methylcarbamate) |
| N,N',2-Trimethyl-2-propyl-1,3-dicarbamoyloxy-propan |
| N,N'-Dimethyl-2-methyl-2-propyl-propandiol-(1.3)-dicarbamat |