inositol pentaphosphate structure
|
Common Name | inositol pentaphosphate | ||
|---|---|---|---|---|
| CAS Number | 25663-09-6 | Molecular Weight | 580.05500 | |
| Density | N/A | Boiling Point | 1106.1ºC at 760 mmHg | |
| Molecular Formula | C6H17O21P5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 622.7ºC | |
| Name | (2-hydroxy-3,4,5,6-tetraphosphonooxycyclohexyl) dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 1106.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H17O21P5 |
| Molecular Weight | 580.05500 |
| Flash Point | 622.7ºC |
| Exact Mass | 579.89500 |
| PSA | 403.08000 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | CTPQAXVNYGZUAJ-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)OC1C(O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| (+-)-myo-Inosit-1,2,3,4,5-pentakis-dihydrogenphosphat |
| 6-hydroxycyclohexane-1,2,3,4,5-pentayl pentakis[dihydrogen(phosphate)] |
| inositol pentaphosphate |
| myo-Inositol pentakis(dihydrogen phosphate) |
| InsP5 |
| Inositol pentakisphosphate |
| Inositol pentis(dihydrogen phosphate) |
| myo-Inositol pentakisphosphate |