Benzoyl chloride,4,4'-(dimethylsilylene)bis
Benzoyl chloride,4,4'-(dimethylsilylene)bis structure
|
Common Name | Benzoyl chloride,4,4'-(dimethylsilylene)bis | ||
|---|---|---|---|---|
| CAS Number | 25664-58-8 | Molecular Weight | 337.27300 | |
| Density | 1.26g/cm3 | Boiling Point | 398.6ºC at 760mmHg | |
| Molecular Formula | C16H14Cl2O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 398.6ºC at 760mmHg |
| Molecular Formula | C16H14Cl2O2Si |
| Molecular Weight | 337.27300 |
| Flash Point | 194.9ºC |
| Exact Mass | 336.01400 |
| PSA | 34.14000 |
| LogP | 3.26720 |
| Vapour Pressure | 1.45E-06mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | HPZPUUUCFWBCFF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(c1ccc(C(=O)Cl)cc1)c1ccc(C(=O)Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Benzoyl chlorid... CAS#:25664-58-8 |
| Literature: Bruma, Maria Revue Roumaine de Chimie, 2008 , vol. 53, # 5 p. 343 - 355 |
![4-[(4-carboxyphenyl)-dimethylsilyl]benzoic acid structure](https://image.chemsrc.com/caspic/029/17003-01-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4'-(dimethylsilanediyl)dibenzoyl chloride |
| bis(4-chloroformyl-phenyl)-dimethyl-silane |
| dimethylbis(4-chlorocarbonylphenyl)silane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride? |
| A: LogP of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride is 3.26720. |
| Q: What is the polar surface area (PSA) of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride? |
| A: Polar surface area (PSA) of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride is 34.14000. |
| Q: What is the InChIKey of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride? |
| A: InChIKey of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride is HPZPUUUCFWBCFF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride? |
| A: Molecular weight of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride is 337.27300. |
| Q: What is the molecular formula of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride? |
| A: Molecular formula of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride is C16H14Cl2O2Si. |
| Q: What is the Chinese name of 25664-58-8? |
| A: Chinese name of 25664-58-8 is 25664-58-8. |
| Q: What English synonyms does 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride have? |
| A: English synonyms of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride: 4,4'-(dimethylsilanediyl)dibenzoyl chloride, bis(4-chloroformyl-phenyl)-dimethyl-silane, dimethylbis(4-chlorocarbonylphenyl)silane. |
| Q: What is the SMILES notation of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride? |
| A: SMILES notation of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride is C[Si](C)(c1ccc(C(=O)Cl)cc1)c1ccc(C(=O)Cl)cc1. |
| Q: What are the upstream materials of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride? |
| A: Related upstream materials(CAS) of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride: 17003-01-9. |
| Q: What is the boiling point of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride? |
| A: Boiling point of 4-[(4-carbonochloridoylphenyl)-dimethylsilyl]benzoyl chloride is 398.6ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |