Acetamide,2-chloro-N,N-dicyclohexyl- structure
|
Common Name | Acetamide,2-chloro-N,N-dicyclohexyl- | ||
|---|---|---|---|---|
| CAS Number | 2567-50-2 | Molecular Weight | 257.79900 | |
| Density | 1.08g/cm3 | Boiling Point | 377.2ºC at 760 mmHg | |
| Molecular Formula | C14H24ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9ºC | |
| Name | 2-chloro-N,N-dicyclohexylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 377.2ºC at 760 mmHg |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.79900 |
| Flash Point | 181.9ºC |
| Exact Mass | 257.15500 |
| PSA | 20.31000 |
| LogP | 3.71920 |
| Vapour Pressure | 6.88E-06mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | YMBSJQHEFLROIX-UHFFFAOYSA-N |
| SMILES | O=C(CCl)N(C1CCCCC1)C1CCCCC1 |
| HS Code | 2924299090 |
|---|
|
~%
Acetamide,2-chl... CAS#:2567-50-2 |
| Literature: Svetkin,Yu.V. J. Gen. Chem. USSR (Engl. Transl.), 1965 , vol. 35, # 5 p. 834 - 836,837 - 839 |
|
~61%
Acetamide,2-chl... CAS#:2567-50-2 |
| Literature: Borowitz, Grace B.; Borowitz, Irving J.; Readio, Josephine D.; Rubinstein, Gabriel; Nirchio, Peter; et al. Tetrahedron, 1989 , vol. 45, # 14 p. 4383 - 4394 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-dicyclohexyl-chloro-acetamide |
| chloro-acetic acid dicyclohexylamide |
| 2-Chloro-N,N-dicyclohexyl-acetamide |
| Chloressigsaeure-dicyclohexylamid |