7-methoxy-5-nitro-1-benzofuran-2-carboxylic acid structure
|
Common Name | 7-methoxy-5-nitro-1-benzofuran-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 25672-29-1 | Molecular Weight | 237.16600 | |
| Density | 1.532g/cm3 | Boiling Point | 457.2ºC at 760 mmHg | |
| Molecular Formula | C10H7NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.3ºC | |
| Name | 7-methoxy-5-nitro-1-benzofuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 457.2ºC at 760 mmHg |
| Molecular Formula | C10H7NO6 |
| Molecular Weight | 237.16600 |
| Flash Point | 230.3ºC |
| Exact Mass | 237.02700 |
| PSA | 105.49000 |
| LogP | 2.57100 |
| Vapour Pressure | 3.74E-09mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | IOZHCNSHXMWQNV-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])cc2cc(C(=O)O)oc12 |
| HS Code | 2932999099 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-methoxy-5-nitro-benzofuran-2-carboxylic acid |