(p-chlorophenoxy)acetic acid, compound with 1,1-dimethylbiguanide (1:1) structure
|
Common Name | (p-chlorophenoxy)acetic acid, compound with 1,1-dimethylbiguanide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 25672-33-7 | Molecular Weight | 315.75600 | |
| Density | 1.28g/cm3 | Boiling Point | 224.1ºC at 760 mmHg | |
| Molecular Formula | C12H18ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 89.3ºC | |
| Name | 2-(4-chlorophenoxy)acetic acid,3-(diaminomethylidene)-1,1-dimethylguanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 224.1ºC at 760 mmHg |
| Molecular Formula | C12H18ClN5O3 |
| Molecular Weight | 315.75600 |
| Flash Point | 89.3ºC |
| Exact Mass | 315.11000 |
| PSA | 135.52000 |
| LogP | 2.05990 |
| Vapour Pressure | 0.0929mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | YMCZETULMSWVBI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=N)N=C(N)N.O=C(O)COc1ccc(Cl)cc1 |
| EINECS 247-177-2 |
| (p-chlorophenoxy)acetic acid,compound with 1,1-dimethylbiguanide (1:1) |
| Acetic acid,(4-chlorophenoxy)-,compd. with N,N-dimethylimidodicarbonimidic diamide (1:1) |
| Glucinan |
| N,N-dimethyl-biguanide salt of p-chlorophenoxy-acetic acid |
| Metformin p-chlorophenoxyacetate (salt) |