Yhhu6669 structure
|
Common Name | Yhhu6669 | ||
|---|---|---|---|---|
| CAS Number | 2569526-80-1 | Molecular Weight | 563.02 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H28ClFN6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Yhhu6669Yhhu6669 is an anti-HBV agent. Yhhu6669 inhibits HBV DNA. Yhhu6669 inhibits HBV replication by inducing the formation of DNA-free capsids. Yhhu6669 decreases HBV DNA and HBcAg in AAV/HBV-infected mice. Yhhu6669 has favorable PK properties[1]. |
| Name | Yhhu6669 |
|---|
| Description | Yhhu6669 is an anti-HBV agent. Yhhu6669 inhibits HBV DNA. Yhhu6669 inhibits HBV replication by inducing the formation of DNA-free capsids. Yhhu6669 decreases HBV DNA and HBcAg in AAV/HBV-infected mice. Yhhu6669 has favorable PK properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H28ClFN6O3 |
|---|---|
| Molecular Weight | 563.02 |
| InChIKey | MHFNNHNOWUKKRM-DEOSSOPVSA-N |
| SMILES | CC(C)C(N)C(=O)OCCCNc1nc(F)c(-c2nn(Cc3ccc(C#N)cc3)c(=O)c3ccccc23)cc1Cl |