4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile
Modify Date: 2025-10-21 19:13:44
![4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile Structure](https://www.chemsrc.com/extcaspic/379/2569564-59-4.png)
4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile structure
|
Common Name | 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 2569564-59-4 | Molecular Weight | 340.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H16N2O2 |
|---|---|
| Molecular Weight | 340.4 |
| InChIKey | FHTPBQKGESWAJF-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(C#N)c(C#N)cc2-c2ccc(OC)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile? |
| A: Molecular formula of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile is C22H16N2O2. |
| Q: What is the Chinese name of 2569564-59-4? |
| A: Chinese name of 2569564-59-4 is 2569564-59-4. |
| Q: What is the SMILES notation of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile? |
| A: SMILES notation of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile is COc1ccc(-c2cc(C#N)c(C#N)cc2-c2ccc(OC)cc2)cc1. |
| Q: What is the molecular weight of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile? |
| A: Molecular weight of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile is 340.4. |
| Q: What is the CAS number of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile? |
| A: CAS number of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile is 2569564-59-4. |
| Q: What is the English name of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile? |
| A: The English name of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile is 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile. |
| Q: What is the InChIKey of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile? |
| A: InChIKey of 4,4''-Dimethoxy-[1,1':2',1''-terphenyl]-4',5'-dicarbonitrile is FHTPBQKGESWAJF-UHFFFAOYSA-N. |