ACTH (1-14)
Modify Date: 2025-09-13 11:52:19
ACTH (1-14) structure
|
Common Name | ACTH (1-14) | ||
|---|---|---|---|---|
| CAS Number | 25696-21-3 | Molecular Weight | 1680.88000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C77H109N21O20S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ACTH (1-14)ACTH (1-14) is a fragment of adrenocorticotrophin, which regulates cortisol and androgen production. |
| Name | H-Ser-Tyr-Ser-Met-Glu-His-Phe-Arg-Trp-Gly-Lys-Pro-Val-Gly-OH |
|---|---|
| Synonym | More Synonyms |
| Description | ACTH (1-14) is a fragment of adrenocorticotrophin, which regulates cortisol and androgen production. |
|---|---|
| Related Catalog | |
| In Vitro | Adrenocorticotropic hormone (ACTH) is a tropic hormone produced by the anterior pituitary, regulates cortisol and androgen production and is associated with Addison disease, Cushing syndrome and Cushing disease[1]. |
| References |
| Molecular Formula | C77H109N21O20S |
|---|---|
| Molecular Weight | 1680.88000 |
| Exact Mass | 1679.79000 |
| PSA | 688.51000 |
| LogP | 2.22150 |
| InChIKey | WKVUCFHTERJJRV-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CO)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(=N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)NC(C(=O)NCC(=O)O)C(C)C |
| Storage condition | 2-8℃ |
| acth (1-14) |