1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one
Modify Date: 2026-07-31 15:37:49
1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one structure
|
Common Name | 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 25700-03-2 | Molecular Weight | 187.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9N3O |
|---|---|
| Molecular Weight | 187.20 |
| InChIKey | CNGZLLDUDMQTEH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(-n2cncn2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one? |
| A: SMILES notation of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one is CC(=O)c1cccc(-n2cncn2)c1. |
| Q: What is the CAS number of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one? |
| A: CAS number of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one is 25700-03-2. |
| Q: What is the English name of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one? |
| A: The English name of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one is 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one. |
| Q: What is the Chinese name of 25700-03-2? |
| A: Chinese name of 25700-03-2 is 25700-03-2. |
| Q: What is the molecular formula of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one? |
| A: Molecular formula of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one is C10H9N3O. |
| Q: What is the InChIKey of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one? |
| A: InChIKey of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one is CNGZLLDUDMQTEH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one? |
| A: Molecular weight of 1-(3-(1h-1,2,4-Triazol-1-yl)phenyl)ethan-1-one is 187.20. |