1-(4-INDOL-1-YL-PHENYL)-ETHANONE structure
|
Common Name | 1-(4-INDOL-1-YL-PHENYL)-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 25700-07-6 | Molecular Weight | 235.28100 | |
| Density | 1.11g/cm3 | Boiling Point | 337.3ºC at 760 mmHg | |
| Molecular Formula | C16H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.8ºC | |
| Name | 1-(4-indol-1-ylphenyl)ethanone |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 337.3ºC at 760 mmHg |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.28100 |
| Flash Point | 157.8ºC |
| Exact Mass | 235.10000 |
| PSA | 22.00000 |
| LogP | 3.83310 |
| Vapour Pressure | 0.000106mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | JIZRDVMJFIUNLP-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(-n2ccc3ccccc32)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |