AKOS BBS-00005393 structure
|
Common Name | AKOS BBS-00005393 | ||
|---|---|---|---|---|
| CAS Number | 2572-44-3 | Molecular Weight | 366.63200 | |
| Density | 1.546g/cm3 | Boiling Point | 555.9ºC at 760mmHg | |
| Molecular Formula | C15H10Cl3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290ºC | |
| Name | 6-chloro-2-N,4-N-bis(4-chlorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.546g/cm3 |
|---|---|
| Boiling Point | 555.9ºC at 760mmHg |
| Molecular Formula | C15H10Cl3N5 |
| Molecular Weight | 366.63200 |
| Flash Point | 290ºC |
| Exact Mass | 365.00000 |
| PSA | 62.73000 |
| LogP | 5.46500 |
| Vapour Pressure | 2.14E-12mmHg at 25°C |
| Index of Refraction | 1.723 |
| InChIKey | QFXLZCCVKGLOAA-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Nc2nc(Cl)nc(Nc3ccc(Cl)cc3)n2)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 6-chloro-N,N'-bis(4-chlorophenyl)-1,3,5-triazine-2,4-diamine |
| 6-Chlor-N2,N4-bis-(4-chlor-phenyl)-[1,3,5]triazin-2,4-diyldiamin |
| 2,4-bischlorophenylamino-6-chloro-s-triazine |
| 6-chloro-N2,N4-bis-(4-chloro-phenyl)-[1,3,5]triazine-2,4-diyldiamine |
| 6-chloro-N2,N4-bis(4-chlorophenyl)-1,3,5-triazine-2,4-diamine |