Succinic acid bis[2-(2-ethylbutoxy)ethyl] ester structure
|
Common Name | Succinic acid bis[2-(2-ethylbutoxy)ethyl] ester | ||
|---|---|---|---|---|
| CAS Number | 25724-60-1 | Molecular Weight | 374.51200 | |
| Density | 0.987g/cm3 | Boiling Point | 436.8ºC at 760 mmHg | |
| Molecular Formula | C20H38O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5ºC | |
| Name | bis[2-(2-ethylbutoxy)ethyl] butanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.987g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760 mmHg |
| Molecular Formula | C20H38O6 |
| Molecular Weight | 374.51200 |
| Flash Point | 184.5ºC |
| Exact Mass | 374.26700 |
| PSA | 71.06000 |
| LogP | 3.75860 |
| Vapour Pressure | 7.83E-08mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | XKBUCJYNRHGGOM-UHFFFAOYSA-N |
| SMILES | CCC(CC)COCCOC(=O)CCC(=O)OCCOCC(CC)CC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| succinic acid bis-[2-(2-ethyl-butoxy)-ethyl ester] |
| Bis(2-(2-ethoxybutoxy)ethyl) succinate |
| Bernsteinsaeure-bis-[2-(2-aethyl-butoxy)-aethylester] |
| Succinic acid,bis(2-(2-ethoxybutoxy)ethyl) ester |