4,4'-Di-n-octyloxyazoxybenzene structure
|
Common Name | 4,4'-Di-n-octyloxyazoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 25729-12-8 | Molecular Weight | 454.64500 | |
| Density | 1.01g/cm3 | Boiling Point | 575.1ºC at 760 mmHg | |
| Molecular Formula | C28H42N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.6ºC | |
| Name | (4-octoxyphenyl)-(4-octoxyphenyl)imino-oxidoazanium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 575.1ºC at 760 mmHg |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.64500 |
| Flash Point | 301.6ºC |
| Exact Mass | 454.32000 |
| PSA | 59.57000 |
| LogP | 9.61410 |
| Vapour Pressure | 1.25E-12mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | LMDKWWQEAJSHLR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(N=[N+]([O-])c2ccc(OCCCCCCCC)cc2)cc1 |
| HS Code | 2927000090 |
|---|
|
~20%
4,4'-Di-n-octyl... CAS#:25729-12-8 |
| Literature: Wada, Shinobu; Urano, Mika; Suzuki, Hitomi Journal of Organic Chemistry, 2002 , vol. 67, # 23 p. 8254 - 8257 |
|
~%
4,4'-Di-n-octyl... CAS#:25729-12-8 |
| Literature: Journal of Organic Chemistry, , vol. 67, # 23 p. 8254 - 8257 |
|
~%
4,4'-Di-n-octyl... CAS#:25729-12-8 |
| Literature: Journal of Organic Chemistry, , vol. 67, # 23 p. 8254 - 8257 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,4'-Dioctyloxy-azoxybenzol |
| p,p'-Dioctyloxy-azoxybenzol |
| 4,4'-Di-n-octyloxyazoxybenzene |
| 4,4'-Di-n-octoxyazoxybenzene |
| 4,4'-Di-n-octyloxyazoxybenzol |
| Di-n-4,4'-octyloxyazoxybenzol |