Hydrazinecarbothioamide,2-(2-amino-9H-purin-6-yl)- structure
|
Common Name | Hydrazinecarbothioamide,2-(2-amino-9H-purin-6-yl)- | ||
|---|---|---|---|---|
| CAS Number | 25732-32-5 | Molecular Weight | 224.24600 | |
| Density | 2.18g/cm3 | Boiling Point | 429ºC at 760 mmHg | |
| Molecular Formula | C6H8N8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.3ºC | |
| Name | [(2-amino-7H-purin-6-yl)amino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 2.18g/cm3 |
|---|---|
| Boiling Point | 429ºC at 760 mmHg |
| Molecular Formula | C6H8N8S |
| Molecular Weight | 224.24600 |
| Flash Point | 213.3ºC |
| Exact Mass | 224.05900 |
| PSA | 165.88000 |
| LogP | 0.18950 |
| Vapour Pressure | 1.45E-07mmHg at 25°C |
| Index of Refraction | 2.097 |
| InChIKey | ASTLQEDCQCCQAZ-UHFFFAOYSA-N |
| SMILES | NC(=S)NNc1nc(N)nc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Amino-6-zhio-semicarbazinopurin |