2,6-diethoxycyclohexa-2,5-diene-1,4-dione
2,6-diethoxycyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2,6-diethoxycyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 25762-79-2 | Molecular Weight | 196.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-diethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12O4 |
|---|---|
| Molecular Weight | 196.20000 |
| Exact Mass | 196.07400 |
| PSA | 52.60000 |
| LogP | 0.97900 |
| InChIKey | KEPINQKIQUMGNT-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=O)C=C(OCC)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,6-diethoxycyc... CAS#:25762-79-2 |
| Literature: Spaeth; Wessely Monatshefte fuer Chemie, 1928 , vol. 49, p. 235 |
|
~%
2,6-diethoxycyc... CAS#:25762-79-2 |
| Literature: Spaeth; Wessely Monatshefte fuer Chemie, 1928 , vol. 49, p. 235 |
|
~%
2,6-diethoxycyc... CAS#:25762-79-2 |
| Literature: Pollak; Goldstein Monatshefte fuer Chemie, 1908 , vol. 29, p. 136 |
|
~%
2,6-diethoxycyc... CAS#:25762-79-2 |
| Literature: Axelsen, V.; Pedersen, J. A. Journal of the Chemical Society, Faraday Transactions 1: Physical Chemistry in Condensed Phases, 1987 , vol. 83, p. 107 - 112 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-Diethoxy-p-benzochinon |
| 2,6-Diaethoxy-[1,4]benzochinon |
| 2,5-Cyclohexadiene-1,4-dione,2,6-diethoxy |
| 2,6-diethoxy-p-benzoquinone |
| 2,6-diethoxybenzoquinone |
| 2,6-diethoxy-[1,4]benzoquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione? |
| A: Molecular formula of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione is C10H12O4. |
| Q: What English synonyms does 2,6-diethoxycyclohexa-2,5-diene-1,4-dione have? |
| A: English synonyms of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione: 2,6-Diethoxy-p-benzochinon, 2,6-Diaethoxy-[1,4]benzochinon, 2,5-Cyclohexadiene-1,4-dione,2,6-diethoxy, 2,6-diethoxy-p-benzoquinone, 2,6-diethoxybenzoquinone, 2,6-diethoxy-[1,4]benzoquinone. |
| Q: What are the upstream materials of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione? |
| A: Related upstream materials(CAS) of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione: 10373-41-8;860560-78-7;78693-57-9;64-17-5;530-55-2. |
| Q: What is the InChIKey of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione? |
| A: InChIKey of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione is KEPINQKIQUMGNT-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione? |
| A: LogP of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione is 0.97900. |
| Q: What is the English name of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione? |
| A: The English name of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione is 2,6-diethoxycyclohexa-2,5-diene-1,4-dione. |
| Q: What is the molecular weight of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione? |
| A: Molecular weight of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione is 196.20000. |
| Q: What is the SMILES notation of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione? |
| A: SMILES notation of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione is CCOC1=CC(=O)C=C(OCC)C1=O. |
| Q: What is the polar surface area (PSA) of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione? |
| A: Polar surface area (PSA) of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione is 52.60000. |
| Q: What is the CAS number of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione? |
| A: CAS number of 2,6-diethoxycyclohexa-2,5-diene-1,4-dione is 25762-79-2. |