2-tert-butyl-4-ethoxyphenol
2-tert-butyl-4-ethoxyphenol structure
|
Common Name | 2-tert-butyl-4-ethoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 25762-84-9 | Molecular Weight | 194.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-tert-butyl-4-ethoxyphenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18O2 |
|---|---|
| Molecular Weight | 194.27000 |
| Exact Mass | 194.13100 |
| PSA | 29.46000 |
| LogP | 3.08840 |
| InChIKey | OMPBXAWNLAWVJJ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(O)c(C(C)(C)C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~21%
2-tert-butyl-4-... CAS#:25762-84-9 |
| Literature: Tanabe Seiyaku Co., Ltd. Patent: US5849732 A1, 1998 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-tert.-Butyl-4-ethoxy-phenol |
| 4-ethoxy-2-tert-butylphenol |
| Phenol,2-(1,1-dimethylethyl)-4-ethoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2-tert-butyl-4-ethoxyphenol? |
| A: Related upstream materials(CAS) of 2-tert-butyl-4-ethoxyphenol: 74-96-4;1948-33-0. |
| Q: What is the Chinese name of 25762-84-9? |
| A: Chinese name of 25762-84-9 is 25762-84-9. |
| Q: What is the molecular formula of 2-tert-butyl-4-ethoxyphenol? |
| A: Molecular formula of 2-tert-butyl-4-ethoxyphenol is C12H18O2. |
| Q: What is the SMILES notation of 2-tert-butyl-4-ethoxyphenol? |
| A: SMILES notation of 2-tert-butyl-4-ethoxyphenol is CCOc1ccc(O)c(C(C)(C)C)c1. |
| Q: What is the CAS number of 2-tert-butyl-4-ethoxyphenol? |
| A: CAS number of 2-tert-butyl-4-ethoxyphenol is 25762-84-9. |
| Q: What English synonyms does 2-tert-butyl-4-ethoxyphenol have? |
| A: English synonyms of 2-tert-butyl-4-ethoxyphenol: 2-tert.-Butyl-4-ethoxy-phenol, 4-ethoxy-2-tert-butylphenol, Phenol,2-(1,1-dimethylethyl)-4-ethoxy. |
| Q: What is the molecular weight of 2-tert-butyl-4-ethoxyphenol? |
| A: Molecular weight of 2-tert-butyl-4-ethoxyphenol is 194.27000. |
| Q: What is the LogP of 2-tert-butyl-4-ethoxyphenol? |
| A: LogP of 2-tert-butyl-4-ethoxyphenol is 3.08840. |
| Q: What is the polar surface area (PSA) of 2-tert-butyl-4-ethoxyphenol? |
| A: Polar surface area (PSA) of 2-tert-butyl-4-ethoxyphenol is 29.46000. |
| Q: What is the English name of 2-tert-butyl-4-ethoxyphenol? |
| A: The English name of 2-tert-butyl-4-ethoxyphenol is 2-tert-butyl-4-ethoxyphenol. |