Fmoc-L-Phe(4-NH-Poc)-OH structure
|
Common Name | Fmoc-L-Phe(4-NH-Poc)-OH | ||
|---|---|---|---|---|
| CAS Number | 2576508-07-9 | Molecular Weight | 484.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-L-Phe(4-NH-Poc)-OHFmoc-L-Phe(4-NH-Poc)-OH is a click chemistry reagent containing an azide group. Used as an orthogonally protected building block in solid-phase peptide synthesis. Poc-group can be further modified using Click-chemistry[1]. |
| Name | Fmoc-L-Phe(4-NH-Poc)-OH |
|---|
| Description | Fmoc-L-Phe(4-NH-Poc)-OH is a click chemistry reagent containing an azide group. Used as an orthogonally protected building block in solid-phase peptide synthesis. Poc-group can be further modified using Click-chemistry[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C28H24N2O6 |
|---|---|
| Molecular Weight | 484.50 |
| InChIKey | MSFSUEVOFDZDOV-VWLOTQADSA-N |
| SMILES | C#CCOC(=O)Nc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |