8-nitro-4-phenylquinoline structure
|
Common Name | 8-nitro-4-phenylquinoline | ||
|---|---|---|---|---|
| CAS Number | 25771-65-7 | Molecular Weight | 250.25200 | |
| Density | 1.29g/cm3 | Boiling Point | 424.1ºC at 760mmHg | |
| Molecular Formula | C15H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.3ºC | |
| Name | 8-nitro-4-phenylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 424.1ºC at 760mmHg |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.25200 |
| Flash Point | 210.3ºC |
| Exact Mass | 250.07400 |
| PSA | 58.71000 |
| LogP | 4.33320 |
| Vapour Pressure | 5.25E-07mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | NKDNDDSXVZUMQC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2c(-c3ccccc3)ccnc12 |
| HS Code | 2933499090 |
|---|
|
~81%
8-nitro-4-pheny... CAS#:25771-65-7 |
| Literature: Kainmueller, Eva K.; Bannwarth, Willi Helvetica Chimica Acta, 2006 , vol. 89, # 12 p. 3056 - 3070 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 247-254-0 |
| Quinoline,8-nitro-4-phenyl |
| 8-nitro-4-phenyl-quinoline |
| 8-Nitro-4-phenyl-chinolin |