2-Phenyl-1H-pyrrolo[3,2-b]pyridine structure
|
Common Name | 2-Phenyl-1H-pyrrolo[3,2-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 25797-03-9 | Molecular Weight | 194.232 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 407.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H10N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.5±14.4 °C | |
| Name | 2-phenyl-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.2±25.0 °C at 760 mmHg |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.232 |
| Flash Point | 185.5±14.4 °C |
| Exact Mass | 194.084396 |
| PSA | 28.68000 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | MHTVGGZESFVQIQ-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2cc3ncccc3[nH]2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrrolo[3,2-b]pyridine, 2-phenyl- |
| 2-Phenyl-4-azaindole |
| 2-phenyl-1H-pyrrolo[3,2-b]pyridine |