rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate
Modify Date: 2026-09-27 06:15:26
![rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate Structure](https://www.chemsrc.com/extcaspic/122/2580098-05-9.png)
rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate structure
|
Common Name | rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2580098-05-9 | Molecular Weight | 205.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15NO2 |
|---|---|
| Molecular Weight | 205.25 |
| InChIKey | JXRSTPHDIGUKAA-WDEREUQCSA-N |
| SMILES | COC(=O)C1CC1c1ccc(CN)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate? |
| A: SMILES notation of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate is COC(=O)C1CC1c1ccc(CN)cc1. |
| Q: What is the InChIKey of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate? |
| A: InChIKey of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate is JXRSTPHDIGUKAA-WDEREUQCSA-N. |
| Q: What is the CAS number of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate? |
| A: CAS number of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate is 2580098-05-9. |
| Q: What is the English name of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate? |
| A: The English name of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate is rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate. |
| Q: What is the Chinese name of 2580098-05-9? |
| A: Chinese name of 2580098-05-9 is 2580098-05-9. |
| Q: What is the molecular weight of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate? |
| A: Molecular weight of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate is 205.25. |
| Q: What is the molecular formula of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate? |
| A: Molecular formula of rac-methyl (1R,2R)-2-[4-(aminomethyl)phenyl]cyclopropane-1-carboxylate is C12H15NO2. |