ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate structure
|
Common Name | ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2580098-32-2 | Molecular Weight | 223.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14FNO2 |
|---|---|
| Molecular Weight | 223.24 |
| InChIKey | HLLFYIWOQBKPIX-NSHDSACASA-N |
| SMILES | CCOC(=O)C1NCCc2cc(F)ccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate? |
| A: CAS number of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate is 2580098-32-2. |
| Q: What is the English name of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate? |
| A: The English name of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate is ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate. |
| Q: What is the SMILES notation of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate? |
| A: SMILES notation of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate is CCOC(=O)C1NCCc2cc(F)ccc21. |
| Q: What is the Chinese name of 2580098-32-2? |
| A: Chinese name of 2580098-32-2 is 2580098-32-2. |
| Q: What is the InChIKey of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate? |
| A: InChIKey of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate is HLLFYIWOQBKPIX-NSHDSACASA-N. |
| Q: What is the molecular formula of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate? |
| A: Molecular formula of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate is C12H14FNO2. |
| Q: What is the molecular weight of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate? |
| A: Molecular weight of ethyl (1S)-6-fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylate is 223.24. |