4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid
Modify Date: 2026-07-08 22:19:16
![4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid Structure](https://www.chemsrc.com/extcaspic/363/2580182-05-2.png)
4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid structure
|
Common Name | 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2580182-05-2 | Molecular Weight | 377.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H19NO5 |
|---|---|
| Molecular Weight | 377.4 |
| InChIKey | WGSSLYFZTCZSGJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(C(=O)O)ccc1OCc1ccccc1)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid? |
| A: Molecular formula of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid is C22H19NO5. |
| Q: What is the InChIKey of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid? |
| A: InChIKey of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid is WGSSLYFZTCZSGJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid? |
| A: Molecular weight of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid is 377.4. |
| Q: What is the CAS number of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid? |
| A: CAS number of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid is 2580182-05-2. |
| Q: What is the SMILES notation of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid? |
| A: SMILES notation of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid is O=C(Nc1cc(C(=O)O)ccc1OCc1ccccc1)OCc1ccccc1. |
| Q: What is the English name of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid? |
| A: The English name of 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid is 4-(Benzyloxy)-3-{[(benzyloxy)carbonyl]amino}benzoic acid. |
| Q: What is the Chinese name of 2580182-05-2? |
| A: Chinese name of 2580182-05-2 is 2580182-05-2. |