Quinoline,4-[2-(bromomethyl)-1,3-dioxolan-2-yl]-6,8-dichloro-2-(3,4-dichlorophenyl)- structure
|
Common Name | Quinoline,4-[2-(bromomethyl)-1,3-dioxolan-2-yl]-6,8-dichloro-2-(3,4-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 25807-05-0 | Molecular Weight | 508.02000 | |
| Density | 1.648g/cm3 | Boiling Point | 615.4ºC at 760mmHg | |
| Molecular Formula | C19H12BrCl4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326ºC | |
| Name | 4-[2-(bromomethyl)-1,3-dioxolan-2-yl]-6,8-dichloro-2-(3,4-dichlorophenyl)quinoline |
|---|
| Density | 1.648g/cm3 |
|---|---|
| Boiling Point | 615.4ºC at 760mmHg |
| Molecular Formula | C19H12BrCl4NO2 |
| Molecular Weight | 508.02000 |
| Flash Point | 326ºC |
| Exact Mass | 504.88100 |
| PSA | 31.35000 |
| LogP | 7.10990 |
| Vapour Pressure | 2.03E-14mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | HIEPWVONEPWUNP-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c2nc(-c3ccc(Cl)c(Cl)c3)cc(C3(CBr)OCCO3)c2c1 |
|
~%
Quinoline,4-[2-... CAS#:25807-05-0 |
| Literature: Singh; Biel Journal of medicinal chemistry, 1970 , vol. 13, # 3 p. 541 - 541 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |