Benzamide,4-hydroxy-3-iodo-5-nitro- structure
|
Common Name | Benzamide,4-hydroxy-3-iodo-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 25845-22-1 | Molecular Weight | 308.03000 | |
| Density | 2.192g/cm3 | Boiling Point | 272.6ºC at 760mmHg | |
| Molecular Formula | C7H5IN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.6ºC | |
| Name | 4-hydroxy-3-iodo-5-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.192g/cm3 |
|---|---|
| Boiling Point | 272.6ºC at 760mmHg |
| Molecular Formula | C7H5IN2O4 |
| Molecular Weight | 308.03000 |
| Flash Point | 118.6ºC |
| Exact Mass | 307.92900 |
| PSA | 109.14000 |
| LogP | 2.22740 |
| Vapour Pressure | 0.00362mmHg at 25°C |
| Index of Refraction | 1.737 |
| InChIKey | YRFMWRRQMUMFMS-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(I)c(O)c([N+](=O)[O-])c1 |
|
~%
Benzamide,4-hyd... CAS#:25845-22-1 |
| Literature: Markus; Kwon Journal of Pharmaceutical Sciences, 1994 , vol. 83, # 12 p. 1729 - 1734 |
|
~26%
Benzamide,4-hyd... CAS#:25845-22-1 |
| Literature: Markus; Kwon Journal of Pharmaceutical Sciences, 1994 , vol. 83, # 12 p. 1729 - 1734 |
|
~%
Benzamide,4-hyd... CAS#:25845-22-1 |
| Literature: Maffei Facino; Pitre; Carini Farmaco, Edizione Scientifica, 1982 , vol. 37, # 7 p. 463 - 474 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-iodo-4-hydroxy-5-nitrobenzamide |