6-tert-butoxycarbonylamino-pyridine-2-carboxylic acid structure
|
Common Name | 6-tert-butoxycarbonylamino-pyridine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 258497-21-1 | Molecular Weight | 238.240 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 360.4±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.8±23.7 °C | |
| Name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.4±27.0 °C at 760 mmHg |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.240 |
| Flash Point | 171.8±23.7 °C |
| Exact Mass | 238.095352 |
| PSA | 88.52000 |
| LogP | 1.17 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | GNGCSXRLPFHKIO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)O)n1 |
| HS Code | 2933399090 |
|---|
|
~%
6-tert-butoxyca... CAS#:258497-21-1 |
| Literature: US6025352 A1, ; US6030965 A1, ; |
|
~45%
6-tert-butoxyca... CAS#:258497-21-1 |
| Literature: Cho, Aesop; Glinka, Tomasz W.; Ludwikow, Maria; Fan, Andrew T.; Wang, Michael; Hecker, Scott J. Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 2 p. 137 - 140 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-pyridinecarboxylic acid, 6-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 6-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-pyridinecarboxylic acid |
| 6-[(tert-Butoxycarbonyl)amino]pyridine-2-carboxylic acid |
| 6-BOC-AMINOPICOLINIC ACID |
| 6-[(tert-butoxycarbonyl)amino]-2-pyridinecarboxylic acid |
| 6-tert-Butoxycarbonylamino-pyridine-2-carboxylic acid |
| 6-N-Boc-aminopicolinic acid |
| 6-[(tert-Butoxycarbonyl)amino]picolinic acid |