(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-bromo-2-methylpropanoate structure
|
Common Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-bromo-2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 258532-05-7 | Molecular Weight | 281.144 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 294.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H17BrO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 131.8±23.2 °C | |
| Name | MFCD24849729 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 294.4±25.0 °C at 760 mmHg |
| Molecular Formula | C10H17BrO4 |
| Molecular Weight | 281.144 |
| Flash Point | 131.8±23.2 °C |
| Exact Mass | 280.031006 |
| LogP | 1.96 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | INSOSKWCXOOGNF-UHFFFAOYSA-N |
| SMILES | CC(C)(Br)C(=O)OC1C(C)(C)C1(O)CO |
| RIDADR | NONH for all modes of transport |
|---|
| OH protected BIB |
| Propanoic acid, 2-bromo-2-methyl-, (2,2-dimethyl-1,3-dioxolan-4-yl)methyl ester |
| ATRP initiator |
| 1-(DL-1,2-Isopropylideneglycerol) 2-bromoisobutyrate |
| (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 2-bromo-2-methylpropanoate |
| MFCD24849729 |