3-(4-methylphenyl)-1-(3-nitrophenyl)prop-2-en-1-one structure
|
Common Name | 3-(4-methylphenyl)-1-(3-nitrophenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 25870-68-2 | Molecular Weight | 267.27900 | |
| Density | 1.226g/cm3 | Boiling Point | 437.6ºC at 760 mmHg | |
| Molecular Formula | C16H13NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 206.9ºC | |
| Name | 3-(4-methylphenyl)-1-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 437.6ºC at 760 mmHg |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.27900 |
| Flash Point | 206.9ºC |
| Exact Mass | 267.09000 |
| PSA | 62.89000 |
| LogP | 4.32250 |
| Vapour Pressure | 7.37E-08mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | CDRXRUCMKRIPTF-MDZDMXLPSA-N |
| SMILES | Cc1ccc(C=CC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
3-(4-methylphen... CAS#:25870-68-2 |
| Literature: Jain, Dinesh K.; Goyal, Neeraj; Bhadoriya, Upendra Asian Journal of Chemistry, 2013 , vol. 25, # 2 p. 789 - 792 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Methyl-3'-nitrochalcon |
| 3-NITRO-4'-METHYL CHALCONE |