4-[3-(4-aminophenyl)-3-oxoprop-1-enyl]benzonitrile structure
|
Common Name | 4-[3-(4-aminophenyl)-3-oxoprop-1-enyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 25870-76-2 | Molecular Weight | 248.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-(4-aminophenyl)-3-oxoprop-1-enyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N2O |
|---|---|
| Molecular Weight | 248.27900 |
| Exact Mass | 248.09500 |
| PSA | 66.88000 |
| LogP | 3.61778 |
| InChIKey | XGLUXNHFMGBZIH-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C=CC(=O)c2ccc(N)cc2)cc1 |
|
~%
4-[3-(4-aminoph... CAS#:25870-76-2 |
| Literature: Dzurilla,M.; Kristian,P. Collection of Czechoslovak Chemical Communications, 1970 , vol. 35, p. 417 - 429 |
|
~%
4-[3-(4-aminoph... CAS#:25870-76-2 |
| Literature: Dzurilla,M.; Kristian,P. Collection of Czechoslovak Chemical Communications, 1970 , vol. 35, p. 417 - 429 |
|
~%
4-[3-(4-aminoph... CAS#:25870-76-2 |
| Literature: Dzurilla,M.; Kristian,P. Collection of Czechoslovak Chemical Communications, 1970 , vol. 35, p. 417 - 429 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Cyano-4'-aminochalcon |
| Benzonitrile,4-[3-(4-aminophenyl)-3-oxo-1-propenyl] |
| 4-Cyan-4'-amino-chalkon |
| 1-<4-Amino-phenyl>-3-<4-cyan-phenyl>-propen-1-on |