1H-Benzotriazole,1-methyl-6-nitro
1H-Benzotriazole,1-methyl-6-nitro structure
|
Common Name | 1H-Benzotriazole,1-methyl-6-nitro | ||
|---|---|---|---|---|
| CAS Number | 25877-35-4 | Molecular Weight | 178.14800 | |
| Density | 1.57g/cm3 | Boiling Point | 377ºC at 760mmHg | |
| Molecular Formula | C7H6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-6-nitrobenzotriazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 377ºC at 760mmHg |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.14800 |
| Flash Point | 181.8ºC |
| Exact Mass | 178.04900 |
| PSA | 76.53000 |
| LogP | 1.39970 |
| Vapour Pressure | 1.51E-05mmHg at 25°C |
| Index of Refraction | 1.733 |
| InChIKey | LWEWBHHHZBJJLP-UHFFFAOYSA-N |
| SMILES | Cn1nnc2ccc([N+](=O)[O-])cc21 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Methyl-6-nitro-1H-1,2,3-benzotriazole |
| 1-Methyl-6-nitro-1,2,3-benzotriazol |
| 1-Methyl-6-nitro-benzotriazol |
| 3-methyl-5-nitrobenzotriazole |
| 1-methyl-6-nitro-1H-benzotriazole |
| 1H-Benzotriazole,1-methyl-6-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-methyl-6-nitrobenzotriazole? |
| A: Molecular formula of 1-methyl-6-nitrobenzotriazole is C7H6N4O2. |
| Q: What is the polar surface area (PSA) of 1-methyl-6-nitrobenzotriazole? |
| A: Polar surface area (PSA) of 1-methyl-6-nitrobenzotriazole is 76.53000. |
| Q: What is the boiling point of 1-methyl-6-nitrobenzotriazole? |
| A: Boiling point of 1-methyl-6-nitrobenzotriazole is 377ºC at 760mmHg. |
| Q: What is the LogP of 1-methyl-6-nitrobenzotriazole? |
| A: LogP of 1-methyl-6-nitrobenzotriazole is 1.39970. |
| Q: What is the English name of 1-methyl-6-nitrobenzotriazole? |
| A: The English name of 1-methyl-6-nitrobenzotriazole is 1-methyl-6-nitrobenzotriazole. |
| Q: What is the InChIKey of 1-methyl-6-nitrobenzotriazole? |
| A: InChIKey of 1-methyl-6-nitrobenzotriazole is LWEWBHHHZBJJLP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 25877-35-4? |
| A: Chinese name of 25877-35-4 is 25877-35-4. |
| Q: What is the CAS number of 1-methyl-6-nitrobenzotriazole? |
| A: CAS number of 1-methyl-6-nitrobenzotriazole is 25877-35-4. |
| Q: What English synonyms does 1-methyl-6-nitrobenzotriazole have? |
| A: English synonyms of 1-methyl-6-nitrobenzotriazole: 1-Methyl-6-nitro-1H-1,2,3-benzotriazole, 1-Methyl-6-nitro-1,2,3-benzotriazol, 1-Methyl-6-nitro-benzotriazol, 3-methyl-5-nitrobenzotriazole, 1-methyl-6-nitro-1H-benzotriazole, 1H-Benzotriazole,1-methyl-6-nitro. |
| Q: What is the SMILES notation of 1-methyl-6-nitrobenzotriazole? |
| A: SMILES notation of 1-methyl-6-nitrobenzotriazole is Cn1nnc2ccc([N+](=O)[O-])cc21. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |