4-chloro-2-nitro-1-(trifluoromethyl)benzene structure
|
Common Name | 4-chloro-2-nitro-1-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 25889-38-7 | Molecular Weight | 225.55200 | |
| Density | 1.537g/cm3 | Boiling Point | 235ºC at 760mmHg | |
| Molecular Formula | C7H3ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.9ºC | |
| Name | 4-chloro-2-nitro-1-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.537g/cm3 |
|---|---|
| Boiling Point | 235ºC at 760mmHg |
| Molecular Formula | C7H3ClF3NO2 |
| Molecular Weight | 225.55200 |
| Flash Point | 95.9ºC |
| Exact Mass | 224.98000 |
| PSA | 45.82000 |
| LogP | 3.79020 |
| Vapour Pressure | 0.0783mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | DDNRGAUZMIFKQS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1C(F)(F)F |
| Storage condition | 2-8°C |
| HS Code | 2904909090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 247-315-1 |
| 4-Chloro-2-nitrobenzotrifluoride |
| 5-chloro-2-trifluoromethylnitrobenzene |