p-[2-[2-(Diisopropylamino)ethoxy]ethyl]aniline structure
|
Common Name | p-[2-[2-(Diisopropylamino)ethoxy]ethyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 25890-99-7 | Molecular Weight | 264.40600 | |
| Density | 0.975g/cm3 | Boiling Point | 369.2ºC at 760mmHg | |
| Molecular Formula | C16H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | 4-[2-[2-[di(propan-2-yl)amino]ethoxy]ethyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 0.975g/cm3 |
|---|---|
| Boiling Point | 369.2ºC at 760mmHg |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.40600 |
| Flash Point | 177.1ºC |
| Exact Mass | 264.22000 |
| PSA | 38.49000 |
| LogP | 3.52790 |
| Vapour Pressure | 1.21E-05mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | ARERBHYOFGDIPC-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCOCCc1ccc(N)cc1)C(C)C |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ANILINE,p-(2-(2-(DIISOPROPYLAMINO)ETHOXY)ETHYL) |
| 1-(p-Aminophenethoxy)-2-di-isopropylamino-ethan |
| p-(2-(2-(Diisopropylamino)ethoxy)ethyl)aniline |
| 4-{2-[2-(dipropan-2-ylamino)ethoxy]ethyl}aniline |