Morpholine,4-(3-phenyl-3-thietanyl)- structure
|
Common Name | Morpholine,4-(3-phenyl-3-thietanyl)- | ||
|---|---|---|---|---|
| CAS Number | 25903-18-8 | Molecular Weight | 235.34500 | |
| Density | 1.205g/cm3 | Boiling Point | 354.8ºC at 760 mmHg | |
| Molecular Formula | C13H17NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.4ºC | |
| Name | 4-(3-phenylthietan-3-yl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 354.8ºC at 760 mmHg |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.34500 |
| Flash Point | 168.4ºC |
| Exact Mass | 235.10300 |
| PSA | 37.77000 |
| LogP | 1.89880 |
| Vapour Pressure | 3.26E-05mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | VAMPPNWJBLPWSL-UHFFFAOYSA-N |
| SMILES | c1ccc(C2(N3CCOCC3)CSC2)cc1 |
|
~%
Morpholine,4-(3... CAS#:25903-18-8 |
| Literature: Siegl,W.O.; Johnson,C.R. Journal of Organic Chemistry, 1970 , vol. 35, p. 3657 - 3663 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Morpholino-3-phenylthietan |