potassium 2,4,6-trichlorophenolate structure
|
Common Name | potassium 2,4,6-trichlorophenolate | ||
|---|---|---|---|---|
| CAS Number | 2591-21-1 | Molecular Weight | 235.53700 | |
| Density | N/A | Boiling Point | 246ºC at 760mmHg | |
| Molecular Formula | C6H2Cl3KO | Melting Point | 69ºC | |
| MSDS | N/A | Flash Point | 95.9ºC | |
| Name | potassium,2,4,6-trichlorophenolate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 246ºC at 760mmHg |
|---|---|
| Melting Point | 69ºC |
| Molecular Formula | C6H2Cl3KO |
| Molecular Weight | 235.53700 |
| Flash Point | 95.9ºC |
| Exact Mass | 233.88100 |
| PSA | 23.06000 |
| LogP | 3.79060 |
| Vapour Pressure | 0.0177mmHg at 25°C |
| InChIKey | UDTHXINPAYGVMM-UHFFFAOYSA-M |
| SMILES | [K+].[O-]c1c(Cl)cc(Cl)cc1Cl |
| HS Code | 2908199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| potassium-<2,4,6-trichloro-phenolate>Potassium 2,4,6-trichlorophenate |
| Potassium 2,4,6-trichlorophenolate |
| EINECS 219-982-9 |
| Potassium 2,4,6-trichlorophenoxide |
| 88-06-2 (Parent) |
| 2,4,6-Trichlorophenol potassium salt |
| potassium salt of 2,4,6-trichlorophenol |