1,4-Naphthalenedione,2-methyl-3-[(phenylmethyl)thio]- structure
|
Common Name | 1,4-Naphthalenedione,2-methyl-3-[(phenylmethyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 2593-59-1 | Molecular Weight | 294.36800 | |
| Density | 1.27g/cm3 | Boiling Point | 455.8ºC at 760mmHg | |
| Molecular Formula | C18H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.2ºC | |
| Name | 2-benzylsulfanyl-3-methylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 455.8ºC at 760mmHg |
| Molecular Formula | C18H14O2S |
| Molecular Weight | 294.36800 |
| Flash Point | 197.2ºC |
| Exact Mass | 294.07100 |
| PSA | 59.44000 |
| LogP | 4.27300 |
| Vapour Pressure | 1.7E-08mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | DVPALWYMAIMQJF-UHFFFAOYSA-N |
| SMILES | CC1=C(SCc2ccccc2)C(=O)c2ccccc2C1=O |
|
~%
1,4-Naphthalene... CAS#:2593-59-1 |
| Literature: Fieser; Brown Journal of the American Chemical Society, 1949 , vol. 71, p. 3615 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(benzylsulfanyl)-3-methylnaphthalene-1,4-dione |
| 2-Benzylmercapto-3-methyl-[1,4]naphthochinon |
| 2-benzylsulfanyl-3-methyl-[1,4]naphthoquinone |