Methyl 4,5-dimethoxy-2-naphthoate structure
|
Common Name | Methyl 4,5-dimethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 25932-94-9 | Molecular Weight | 246.25900 | |
| Density | 1.175g/cm3 | Boiling Point | 386.9ºC at 760 mmHg | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.3ºC | |
| Name | Methyl 4,5-dimethoxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 386.9ºC at 760 mmHg |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.25900 |
| Flash Point | 172.3ºC |
| Exact Mass | 246.08900 |
| PSA | 44.76000 |
| LogP | 2.64360 |
| Vapour Pressure | 3.43E-06mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | DEJACCSNPLFWHZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(OC)cccc2c1 |
|
~%
Methyl 4,5-dime... CAS#:25932-94-9 |
|
Literature: Harper,S.H. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , vol. |
|
~%
Methyl 4,5-dime... CAS#:25932-94-9 |
|
Literature: Harper,S.H. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , vol. |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,5-Dimethoxy-2-naphthoesaeuremethylester |
| 4,5-dimethoxy-2-methylphenyl methyl sulfone |
| 4,5-Dimethoxy-2-methylsulfon-1-methylbenzol |
| 4,5-Dimethoxy-2-methylphenyl methyl sulphone |