1-Phthalazineaceticacid, 3,4-dihydro-4-oxo-, hydrazide structure
|
Common Name | 1-Phthalazineaceticacid, 3,4-dihydro-4-oxo-, hydrazide | ||
|---|---|---|---|---|
| CAS Number | 25947-18-6 | Molecular Weight | 218.21200 | |
| Density | 1.53g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-oxo-3H-phthalazin-1-yl)acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.21200 |
| Exact Mass | 218.08000 |
| PSA | 100.87000 |
| LogP | 0.54670 |
| Index of Refraction | 1.723 |
| InChIKey | LRYHCCVJXQEMLN-UHFFFAOYSA-N |
| SMILES | NNC(=O)Cc1n[nH]c(=O)c2ccccc12 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Phthalazon-4-yl-1-essigsaeure-hydrazid |
| 1-phthalazineacetic acid,3,4-dihydro-4-oxo-,hydrazide |