2-[(5-Nitro-2-pyridyl)amino]ethanol structure
|
Common Name | 2-[(5-Nitro-2-pyridyl)amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 25948-12-3 | Molecular Weight | 183.16500 | |
| Density | 1.431 g/cm3 | Boiling Point | 401.9ºC at 760 mmHg | |
| Molecular Formula | C7H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9ºC | |
| Name | 2-[(5-nitropyridin-2-yl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431 g/cm3 |
|---|---|
| Boiling Point | 401.9ºC at 760 mmHg |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.16500 |
| Flash Point | 196.9ºC |
| Exact Mass | 183.06400 |
| PSA | 90.97000 |
| LogP | 0.99020 |
| Vapour Pressure | 3.5E-07mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | STGZMDMCSWZWHU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCCO)nc1 |
| HS Code | 2933399090 |
|---|
|
~91%
2-[(5-Nitro-2-p... CAS#:25948-12-3 |
| Literature: WO2013/13817 A1, ; Page/Page column 113; 114 ; WO 2013/013817 A1 |
|
~%
2-[(5-Nitro-2-p... CAS#:25948-12-3 |
| Literature: US4950302 A1, ; |
|
~%
2-[(5-Nitro-2-p... CAS#:25948-12-3 |
| Literature: WO2013/13815 A1, ; WO 2013/013815 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-Hydroxyethylamino)-5-nitropyridin |
| 2-(5-nitropyridin-2-ylamino)ethanol |
| 2-(5-Nitro-[2]pyridylamino)-aethanol |
| 2-((2'-hydroxy-ethyl)amino)-5-nitropyridine |
| 2-[(5-nitro-2-pyridyl)amino]ethanol |
| 2-(5-NITRO-2-PYRIDYLAMINO)-ETHANOL |
| 2-[(5-Nitropyridin-2-yl)amino]ethanol hydrochloride |