3-ethyl-5-(1-ethyl-(1H)-pyridin-4-ylidene)-2-thioxothiazolidin-4-one structure
|
Common Name | 3-ethyl-5-(1-ethyl-(1H)-pyridin-4-ylidene)-2-thioxothiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 25962-08-7 | Molecular Weight | 282.46100 | |
| Density | 1.34g/cm3 | Boiling Point | 316.7ºC at 760 mmHg | |
| Molecular Formula | C18H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.4ºC | |
| Name | 5,10-diethyltetradec-7-yne-6,9-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 316.7ºC at 760 mmHg |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.46100 |
| Flash Point | 145.4ºC |
| Exact Mass | 282.25600 |
| PSA | 40.46000 |
| LogP | 4.14440 |
| Vapour Pressure | 0.000402mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | URVNGLXEYBEJIN-UHFFFAOYSA-N |
| SMILES | CCN1C=CC(=C2SC(=S)N(CC)C2=O)C=C1 |
| HS Code | 2934999090 |
|---|
|
~%
3-ethyl-5-(1-et... CAS#:25962-08-7 |
| Literature: Brooker et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 5326,5330 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,10-Diethyl-7-tetradecyn-6,9-diol |
| Merocyanin 2 |
| 3-ethyl-5-(1-ethyl-1H-[4]pyridylidene)-2-thioxo-thiazolidin-4-one |
| EINECS 246-975-8 |
| 7-Tetradecyne-6,9-diol,5,10-diethyl |
| 3-ethyl-5-(1-ethyl-1H-pyridin-4-ylidene)-2-thioxo-thiazolidin-4-one |
| 3-Aethyl-5-(1-aethyl-1H-[4]pyridyliden)-2-thioxo-thiazolidin-4-on |