(Perfluorocyclohexyl)methanol structure
|
Common Name | (Perfluorocyclohexyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 25965-83-7 | Molecular Weight | 380.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7F11O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H7F11O2 |
|---|---|
| Molecular Weight | 380.15500 |
| Exact Mass | 380.02700 |
| PSA | 26.30000 |
| LogP | 4.00410 |
| InChIKey | DZZAHYHMWKNGLC-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| pc0071 |