dmean structure
|
Common Name | dmean | ||
|---|---|---|---|---|
| CAS Number | 259739-01-0 | Molecular Weight | 291.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dmean |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H17N3O |
|---|---|
| Molecular Weight | 291.34700 |
| Exact Mass | 291.13700 |
| PSA | 71.05000 |
| LogP | 3.08896 |
| InChIKey | XNRULZQPCJXTMC-UHFFFAOYSA-N |
| SMILES | CC(=C(C#N)C#N)c1ccc2cc(N(C)CCO)ccc2c1 |
|
~84%
dmean CAS#:259739-01-0 |
| Literature: Cui, Mengchao; Tang, Ruikun; Li, Zijing; Ren, Huiying; Liu, Boli Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 3 p. 1064 - 1068 |
|
~%
dmean CAS#:259739-01-0 |
| Literature: Cui, Mengchao; Tang, Ruikun; Li, Zijing; Ren, Huiying; Liu, Boli Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 3 p. 1064 - 1068 |
|
~%
dmean CAS#:259739-01-0 |
| Literature: Cui, Mengchao; Tang, Ruikun; Li, Zijing; Ren, Huiying; Liu, Boli Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 3 p. 1064 - 1068 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| PROPANEDINITRILE,[1-[6-[METHYL[2-[HYDROXY]ETHYL]AMINO]-2-NAPHTHALENYL]ETHYLIDENE] |
| 2-(1-(6-[((2-HYDROXY)ETHYL)(METHYL)AMINO]-2-NAPHTHYL)ETHYLIDEN)MALONITRILE |
| 2-(1-(6-[((2-HYDROXY)ETHYL)(METHYL)AMINO]-2-NAPHTHYL)ETHYLIDENE)MALONITRILE |
| (2-(1,1-DICYANOPROPEN-2-YL)-6-METHYL-(2-HYDROXOETHYL)-AMINO)-NAPHTHALENE |
| 2-(1-{6-[(2-hydroxyethyl)(methyl)amino]-2-naphthyl}ethylidene)malononitrile |
| 2-(1,1-dicyanopropen-2-yl)-6-[(2-hydroxyethyl)-methyl-amino]-naphthalene |
| 2-(1-(6-((2-hydroxyethyl)(methyl)amino)naphthalen-2-yl)ethylidene)malononitrile |