4-(6-Chloro-1,3-benzothiazol-2-yl)morpholine structure
|
Common Name | 4-(6-Chloro-1,3-benzothiazol-2-yl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 259792-68-2 | Molecular Weight | 254.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(6-Chloro-1,3-benzothiazol-2-yl)morpholine |
|---|
| Molecular Formula | C11H11ClN2OS |
|---|---|
| Molecular Weight | 254.74 |
| InChIKey | WZVBFKNDFYWFFW-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC3=C(S2)C=C(C=C3)Cl |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|