benzene-1,3-diol,formaldehyde,phenol structure
|
Common Name | benzene-1,3-diol,formaldehyde,phenol | ||
|---|---|---|---|---|
| CAS Number | 25986-71-4 | Molecular Weight | 234.24800 | |
| Density | N/A | Boiling Point | 280ºC at 760 mmHg | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.9ºC | |
| Name | benzene-1,3-diol,formaldehyde,phenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 280ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.24800 |
| Flash Point | 131.9ºC |
| Exact Mass | 234.08900 |
| PSA | 77.76000 |
| LogP | 2.94100 |
| Vapour Pressure | 0.00229mmHg at 25°C |
| InChIKey | QDNBHWFDWXWFTG-UHFFFAOYSA-N |
| SMILES | C=O.Oc1cccc(O)c1.Oc1ccccc1 |
| Phenol,resorcin,formaldehyde resin |
| Resorcinol,formaldehyde,phenol polymer |
| Phenol,resorcin,formaldehyde polymer |
| Formaldehyde,polymer with 1,3-benzenediol and phenol |