dibutyl (E)-but-2-enedioate,ethenyl acetate structure
|
Common Name | dibutyl (E)-but-2-enedioate,ethenyl acetate | ||
|---|---|---|---|---|
| CAS Number | 25989-00-8 | Molecular Weight | 314.37400 | |
| Density | N/A | Boiling Point | 280ºC at 760mmHg | |
| Molecular Formula | C16H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.4ºC | |
| Name | dibutyl (E)-but-2-enedioate,ethenyl acetate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 280ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.37400 |
| Flash Point | 136.4ºC |
| Exact Mass | 314.17300 |
| PSA | 78.90000 |
| LogP | 2.92220 |
| Vapour Pressure | 0.00388mmHg at 25°C |
| InChIKey | VPSZKCCWOGZNLS-USRGLUTNSA-N |
| SMILES | C=COC(C)=O.CCCCOC(=O)C=CC(=O)OCCCC |
| Ethenyl acetate,polymer with dibutyl 2-butenedioate (E) |
| 2-Butenedioic acid (2E)-,1,4-dibutyl ester,polymer with ethenyl acetate |
| 2-Butenedioic acid (2E)-,dibutyl ester,polymer with ethenyl acetate |
| 2-Butenedioic acid (E)-,dibutyl ester,polymer with ethenyl acetate |
| Vinyl acetate-dibutyl fumarate copolymer |