Benzenemethanamine,2,4-dimethoxy-N,N,6-trimethyl
Modify Date: 2026-08-03 10:22:58
Benzenemethanamine,2,4-dimethoxy-N,N,6-trimethyl structure
|
Common Name | Benzenemethanamine,2,4-dimethoxy-N,N,6-trimethyl | ||
|---|---|---|---|---|
| CAS Number | 26050-73-7 | Molecular Weight | 209.28500 | |
| Density | 0.995g/cm3 | Boiling Point | 282.5ºC at 760mmHg | |
| Molecular Formula | C12H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 89.9ºC | |
| Name | 4,4,4-Trifluorbutyl-dimethylsilan |
|---|---|
| Synonym | More Synonyms |
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 282.5ºC at 760mmHg |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.28500 |
| Flash Point | 89.9ºC |
| Exact Mass | 209.14200 |
| PSA | 21.70000 |
| LogP | 2.07380 |
| Vapour Pressure | 0.00334mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | DVUDUXDSNSSIIU-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(CN(C)C)c(OC)c1 |
|
~%
Benzenemethanam... CAS#:26050-73-7 |
| Literature: Beard,W.Q. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 2310 - 2316 |
|
~%
Benzenemethanam... CAS#:26050-73-7 |
| Literature: Beard,W.Q. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 2310 - 2316 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:527-55-9
CAS#:3686-57-5| dimethyl-(4,4,4-trifluoro-butyl)-silane |
| Silane,dimethyl(4,4,4-trifluorobutyl) |
| N,N-Dimethyl-2,4-dimethoxy-6-methylbenzylamine |
| Dimethyl-(4,6-dimethoxy-2-methyl-benzyl)-amin |
| Dimethyl-<4-trifluor-butyl-(1)>-silan |
| Dimethyl-(4,4,4-trifluor-butyl)-silan |