4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate
Modify Date: 2025-09-10 11:47:09
4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate structure
|
Common Name | 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 26059-37-0 | Molecular Weight | 282.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22O3S |
|---|---|
| Molecular Weight | 282.4 |
| InChIKey | BYJQCDYJCHJBCS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(C)(C)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate? |
| A: InChIKey of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate is BYJQCDYJCHJBCS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate? |
| A: Molecular weight of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate is 282.4. |
| Q: What is the English name of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate? |
| A: The English name of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate is 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate. |
| Q: What is the CAS number of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate? |
| A: CAS number of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate is 26059-37-0. |
| Q: What is the Chinese name of 26059-37-0? |
| A: Chinese name of 26059-37-0 is 26059-37-0. |
| Q: What is the molecular formula of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate? |
| A: Molecular formula of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate is C15H22O3S. |
| Q: What is the SMILES notation of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate? |
| A: SMILES notation of 4,4-Dimethylcyclohexyl 4-methylbenzene-1-sulfonate is Cc1ccc(S(=O)(=O)OC2CCC(C)(C)CC2)cc1. |