N3-Gly-Aeg(Fmoc)-OH
Modify Date: 2025-08-27 09:53:27
N3-Gly-Aeg(Fmoc)-OH structure
|
Common Name | N3-Gly-Aeg(Fmoc)-OH | ||
|---|---|---|---|---|
| CAS Number | 2606227-07-8 | Molecular Weight | 423.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N3-Gly-Aeg(Fmoc)-OHN3-Gly-Aeg(Fmoc)-OH is a click chemistry reagent containing an azide group. PNA building-block that can be further modified using Click-chemistry[1]. |
| Name | N3-Gly-Aeg(Fmoc)-OH |
|---|
| Description | N3-Gly-Aeg(Fmoc)-OH is a click chemistry reagent containing an azide group. PNA building-block that can be further modified using Click-chemistry[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H21N5O5 |
|---|---|
| Molecular Weight | 423.42 |
| InChIKey | OYUSDQQCLGZRFC-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCC(=O)N(CCNC(=O)OCC1c2ccccc2-c2ccccc21)CC(=O)O |