2,4-Pentadienal, 5-(4-nitrophenyl)- structure
|
Common Name | 2,4-Pentadienal, 5-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2608-48-2 | Molecular Weight | 203.19400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2E,4E)-5-(4-Nitrophenyl)penta-2,4-dienal |
|---|
| Molecular Formula | C11H9NO3 |
|---|---|
| Molecular Weight | 203.19400 |
| Exact Mass | 203.05800 |
| PSA | 62.89000 |
| LogP | 2.88630 |
| Vapour Pressure | 2.29E-05mmHg at 25°C |
| InChIKey | BKLWQDSDJBFRDF-TZFCGSKZSA-N |
| SMILES | O=CC=CC=Cc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2913000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |