10H-phenoxazine ion structure
|
Common Name | 10H-phenoxazine ion | ||
|---|---|---|---|---|
| CAS Number | 261-79-0 | Molecular Weight | 183.20600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9NO+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10H-phenoxazine ion |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9NO+ |
|---|---|
| Molecular Weight | 183.20600 |
| Exact Mass | 183.06800 |
| PSA | 28.93000 |
| LogP | 3.47630 |
| InChIKey | TZMSYXZUNZXBOL-UHFFFAOYSA-O |
| SMILES | c1ccc2c(c1)Nc1ccccc1[OH+]2 |
|
~%
10H-phenoxazine ion CAS#:261-79-0 |
| Literature: Kemp, Terence J.; Moore, Peter; Quick, Geoffrey R. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 291 - 295 |
|
~%
10H-phenoxazine ion CAS#:261-79-0 |
| Literature: Kemp, Terence J.; Moore, Peter; Quick, Geoffrey R. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 291 - 295 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| phenoxazinium ion |
| phenothiazino-10-acetyl chloride |