2-[chloro(fluoro)methoxy]-1,1,1,3,3,3-hexafluoropropane structure
|
Common Name | 2-[chloro(fluoro)methoxy]-1,1,1,3,3,3-hexafluoropropane | ||
|---|---|---|---|---|
| CAS Number | 26103-09-3 | Molecular Weight | 234.50000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H2ClF7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[chloro(fluoro)methoxy]-1,1,1,3,3,3-hexafluoropropane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H2ClF7O |
|---|---|
| Molecular Weight | 234.50000 |
| Exact Mass | 233.96800 |
| PSA | 9.23000 |
| LogP | 2.98810 |
| InChIKey | LOSXVSQQCOVCHO-UHFFFAOYSA-N |
| SMILES | FC(Cl)OC(C(F)(F)F)C(F)(F)F |
|
~%
2-[chloro(fluor... CAS#:26103-09-3 |
| Literature: Speers,L. et al. Journal of Medicinal Chemistry, 1971 , vol. 14, p. 593 - 595 |
|
~34%
2-[chloro(fluor... CAS#:26103-09-3 |
| Literature: Rozov, Leonid A.; Lessor, Ralph A.; Kudzma, Linas V.; Ramig, Keith Journal of Fluorine Chemistry, 1998 , vol. 88, # 1 p. 51 - 54 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 1,1,1,3,3,3-Hexafluorisopropyl-chlorfluormethyl-ether |
| Propane,2-(chlorofluoromethoxy)-1,1,1,3,3,3-hexafluoro |
| 1,1,1,3,3,3-hexafluoroisopropyl chlorofluoromethyl ether |